C17H25N7S — CID 111707333
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine (PubChem CID 111707333) has the molecular formula C17H25N7S and a molecular weight of 359.50 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111707333 |
| Molecular Formula | C17H25N7S |
| Molecular Weight | 359.50 g/mol |
| Exact Mass | 359.19 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-thiomorpholin-4-ylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(N2CCSCC2)cc1)NCc1ncnn1C |
| InChI | InChI=1S/C17H25N7S/c1-18-17(20-12-16-21-13-22-23(16)2)19-11-14-3-5-15(6-4-14)24-7-9-25-10-8-24/h3-6,13H,7-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | BEZUYRCEKBADCA-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.50 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|