C17H25N7O2S — CID 111706961
2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111706961) has the molecular formula C17H25N7O2S and a molecular weight of 391.50 g/mol. Its IUPAC name is 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111706961 |
| Molecular Formula | C17H25N7O2S |
| Molecular Weight | 391.50 g/mol |
| Exact Mass | 391.18 |
| IUPAC Name | 2-methyl-1-[(2-methyl-1,2,4-triazol-3-yl)methyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCC2)cc1)NCc1ncnn1C |
| InChI | InChI=1S/C17H25N7O2S/c1-18-17(20-12-16-21-13-22-23(16)2)19-11-14-5-7-15(8-6-14)27(25,26)24-9-3-4-10-24/h5-8,13H,3-4,9-12H2,1-2H3,(H2,18,19,20) |
| InChIKey | OCSYYCALSGHPKG-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.50 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|