C20H30N6O2S — CID 111905029
2-methyl-1-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine (PubChem CID 111905029) has the molecular formula C20H30N6O2S and a molecular weight of 418.57 g/mol. Its IUPAC name is 2-methyl-1-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine.
| Compound Name | 2-methyl-1-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111905029 |
| Molecular Formula | C20H30N6O2S |
| Molecular Weight | 418.57 g/mol |
| Exact Mass | 418.22 |
| IUPAC Name | 2-methyl-1-[(4-piperidin-1-ylsulfonylphenyl)methyl]-3-(3-pyrazol-1-ylpropyl)guanidine |
| SMILES | C/N=C(\NCCCn1cccn1)NCc1ccc(S(=O)(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C20H30N6O2S/c1-21-20(22-11-5-13-25-14-6-12-24-25)23-17-18-7-9-19(10-8-18)29(27,28)26-15-3-2-4-16-26/h6-10,12,14H,2-5,11,13,15-17H2,1H3,(H2,21,22,23) |
| InChIKey | OYKDXURRUJQKDW-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 91.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.57 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|