C22H37N5O2S — CID 111371039
2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine (PubChem CID 111371039) has the molecular formula C22H37N5O2S and a molecular weight of 435.64 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
|---|---|
| PubChem CID | 111371039 |
| Molecular Formula | C22H37N5O2S |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[(4-pyrrolidin-1-ylsulfonylphenyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCCCC1C)NCc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C22H37N5O2S/c1-19-8-3-4-14-26(19)15-7-13-24-22(23-2)25-18-20-9-11-21(12-10-20)30(28,29)27-16-5-6-17-27/h9-12,19H,3-8,13-18H2,1-2H3,(H2,23,24,25) |
| InChIKey | WBBJNYYXYVIYQD-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 77.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|