C22H35N5 — CID 111797054
1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine (PubChem CID 111797054) has the molecular formula C22H35N5 and a molecular weight of 369.56 g/mol. Its IUPAC name is 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine.
| Compound Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111797054 |
| Molecular Formula | C22H35N5 |
| Molecular Weight | 369.56 g/mol |
| Exact Mass | 369.29 |
| IUPAC Name | 1-[[4-(2,5-dihydropyrrol-1-yl)phenyl]methyl]-2-methyl-3-[3-(2-methylpiperidin-1-yl)propyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCCCC1C)NCc1ccc(N2CC=CC2)cc1 |
| InChI | InChI=1S/C22H35N5/c1-19-8-3-4-14-26(19)17-7-13-24-22(23-2)25-18-20-9-11-21(12-10-20)27-15-5-6-16-27/h5-6,9-12,19H,3-4,7-8,13-18H2,1-2H3,(H2,23,24,25) |
| InChIKey | FHVOKSPSNWJJTI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 42.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.56 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|