C21H31N5 — CID 111969015
2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-(quinolin-4-ylmethyl)guanidine (PubChem CID 111969015) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-(quinolin-4-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-(quinolin-4-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111969015 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-(quinolin-4-ylmethyl)guanidine |
| SMILES | C/N=C(\NCCCN1CCCCC1C)NCc1ccnc2ccccc12 |
| InChI | InChI=1S/C21H31N5/c1-17-8-5-6-14-26(17)15-7-12-24-21(22-2)25-16-18-11-13-23-20-10-4-3-9-19(18)20/h3-4,9-11,13,17H,5-8,12,14-16H2,1-2H3,(H2,22,24,25) |
| InChIKey | GHSFSWUVNRUOJH-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 52.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|