C20H31N7 — CID 111371511
2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine (PubChem CID 111371511) has the molecular formula C20H31N7 and a molecular weight of 369.52 g/mol. Its IUPAC name is 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine.
| Compound Name | 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
|---|---|
| PubChem CID | 111371511 |
| Molecular Formula | C20H31N7 |
| Molecular Weight | 369.52 g/mol |
| Exact Mass | 369.26 |
| IUPAC Name | 2-methyl-1-[3-(2-methylpiperidin-1-yl)propyl]-3-[(2-pyrazol-1-yl-4-pyridinyl)methyl]guanidine |
| SMILES | C/N=C(\NCCCN1CCCCC1C)NCc1ccnc(-n2cccn2)c1 |
| InChI | InChI=1S/C20H31N7/c1-17-7-3-4-12-26(17)13-5-9-23-20(21-2)24-16-18-8-11-22-19(15-18)27-14-6-10-25-27/h6,8,10-11,14-15,17H,3-5,7,9,12-13,16H2,1-2H3,(H2,21,23,24) |
| InChIKey | HUQFSNVFAQKSLG-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 70.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.52 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|