C19H29N7O2S — CID 111708213
2-methyl-1-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine (PubChem CID 111708213) has the molecular formula C19H29N7O2S and a molecular weight of 419.56 g/mol. Its IUPAC name is 2-methyl-1-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine.
| Compound Name | 2-methyl-1-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111708213 |
| Molecular Formula | C19H29N7O2S |
| Molecular Weight | 419.56 g/mol |
| Exact Mass | 419.21 |
| IUPAC Name | 2-methyl-1-[[4-(3-methylpiperidin-1-yl)sulfonylphenyl]methyl]-3-[(2-methyl-1,2,4-triazol-3-yl)methyl]guanidine |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)N2CCCC(C)C2)cc1)NCc1ncnn1C |
| InChI | InChI=1S/C19H29N7O2S/c1-15-5-4-10-26(13-15)29(27,28)17-8-6-16(7-9-17)11-21-19(20-2)22-12-18-23-14-24-25(18)3/h6-9,14-15H,4-5,10-13H2,1-3H3,(H2,20,21,22) |
| InChIKey | KJTCYIFEUOPHSW-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 104.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.56 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|