C16H29IN4O3S — CID 110965310
1-tert-butyl-3-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylguanidine;hydroiodide (PubChem CID 110965310) has the molecular formula C16H29IN4O3S and a molecular weight of 484.40 g/mol. Its IUPAC name is 1-tert-butyl-3-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-tert-butyl-3-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 110965310 |
| Molecular Formula | C16H29IN4O3S |
| Molecular Weight | 484.40 g/mol |
| Exact Mass | 484.10 |
| IUPAC Name | 1-tert-butyl-3-[[4-(2-methoxyethylsulfamoyl)phenyl]methyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(/NCc1ccc(S(=O)(=O)NCCOC)cc1)NC(C)(C)C.I |
| InChI | InChI=1S/C16H28N4O3S.HI/c1-16(2,3)20-15(17-4)18-12-13-6-8-14(9-7-13)24(21,22)19-10-11-23-5;/h6-9,19H,10-12H2,1-5H3,(H2,17,18,20);1H |
| InChIKey | GUOUBNDSFDZVAW-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 91.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.40 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|