C12H18N2O7 — CID 175652948
N-(furan-2-ylmethyl)-2-(2-methoxyethylamino)acetamide;oxalic acid (PubChem CID 175652948) has the molecular formula C12H18N2O7 and a molecular weight of 302.28 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-2-(2-methoxyethylamino)acetamide;oxalic acid.
| Compound Name | N-(furan-2-ylmethyl)-2-(2-methoxyethylamino)acetamide;oxalic acid |
|---|---|
| PubChem CID | 175652948 |
| Molecular Formula | C12H18N2O7 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.11 |
| IUPAC Name | N-(furan-2-ylmethyl)-2-(2-methoxyethylamino)acetamide;oxalic acid |
| SMILES | COCCNCC(=O)NCc1ccco1.O=C(O)C(=O)O |
| InChI | InChI=1S/C10H16N2O3.C2H2O4/c1-14-6-4-11-8-10(13)12-7-9-3-2-5-15-9;3-1(4)2(5)6/h2-3,5,11H,4,6-8H2,1H3,(H,12,13);(H,3,4)(H,5,6) |
| InChIKey | SHJZPIFGAFEKTH-UHFFFAOYSA-N |
| XLogP | -0.71 |
| TPSA | 138.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | -0.71 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|