C15H19N3O3 — CID 111507627
1-(3-hydroxybutyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]urea (PubChem CID 111507627) has the molecular formula C15H19N3O3 and a molecular weight of 289.33 g/mol. Its IUPAC name is 1-(3-hydroxybutyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]urea.
| Compound Name | 1-(3-hydroxybutyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 111507627 |
| Molecular Formula | C15H19N3O3 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.14 |
| IUPAC Name | 1-(3-hydroxybutyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]urea |
| SMILES | CC(O)CCNC(=O)NCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C15H19N3O3/c1-11(19)7-8-16-15(20)17-9-13-10-21-14(18-13)12-5-3-2-4-6-12/h2-6,10-11,19H,7-9H2,1H3,(H2,16,17,20) |
| InChIKey | KZIKQCAXYRCIAZ-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |