C17H23N3O3 — CID 111507637
1-(2-ethyl-2-hydroxybutyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]urea (PubChem CID 111507637) has the molecular formula C17H23N3O3 and a molecular weight of 317.39 g/mol. Its IUPAC name is 1-(2-ethyl-2-hydroxybutyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]urea.
| Compound Name | 1-(2-ethyl-2-hydroxybutyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]urea |
|---|---|
| PubChem CID | 111507637 |
| Molecular Formula | C17H23N3O3 |
| Molecular Weight | 317.39 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 1-(2-ethyl-2-hydroxybutyl)-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]urea |
| SMILES | CCC(O)(CC)CNC(=O)NCc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C17H23N3O3/c1-3-17(22,4-2)12-19-16(21)18-10-14-11-23-15(20-14)13-8-6-5-7-9-13/h5-9,11,22H,3-4,10,12H2,1-2H3,(H2,18,19,21) |
| InChIKey | HRCNZYMLWVTKGE-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.39 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |