C22H23FN6 — CID 111972698
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine (PubChem CID 111972698) has the molecular formula C22H23FN6 and a molecular weight of 390.47 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111972698 |
| Molecular Formula | C22H23FN6 |
| Molecular Weight | 390.47 g/mol |
| Exact Mass | 390.20 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(1-phenylpyrazol-4-yl)methyl]guanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1cnn(-c2ccccc2)c1 |
| InChI | InChI=1S/C22H23FN6/c1-24-22(25-10-9-17-14-26-21-8-7-18(23)11-20(17)21)27-12-16-13-28-29(15-16)19-5-3-2-4-6-19/h2-8,11,13-15,26H,9-10,12H2,1H3,(H2,24,25,27) |
| InChIKey | FHGBQKOMQDNXNM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|