C21H23FIN7 — CID 111972823
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide (PubChem CID 111972823) has the molecular formula C21H23FIN7 and a molecular weight of 519.37 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111972823 |
| Molecular Formula | C21H23FIN7 |
| Molecular Weight | 519.37 g/mol |
| Exact Mass | 519.10 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[[4-(1,2,4-triazol-1-yl)phenyl]methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1ccc(-n2cncn2)cc1.I |
| InChI | InChI=1S/C21H22FN7.HI/c1-23-21(25-9-8-16-12-26-20-7-4-17(22)10-19(16)20)27-11-15-2-5-18(6-3-15)29-14-24-13-28-29;/h2-7,10,12-14,26H,8-9,11H2,1H3,(H2,23,25,27);1H |
| InChIKey | CSFOLQDQNJXZIG-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.37 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|