C16H21FIN7 — CID 111972171
1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111972171) has the molecular formula C16H21FIN7 and a molecular weight of 457.30 g/mol. Its IUPAC name is 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111972171 |
| Molecular Formula | C16H21FIN7 |
| Molecular Weight | 457.30 g/mol |
| Exact Mass | 457.09 |
| IUPAC Name | 1-[2-(5-fluoro-1H-indol-3-yl)ethyl]-2-methyl-3-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | C/N=C(/NCCc1c[nH]c2ccc(F)cc12)NCc1nncn1C.I |
| InChI | InChI=1S/C16H20FN7.HI/c1-18-16(21-9-15-23-22-10-24(15)2)19-6-5-11-8-20-14-4-3-12(17)7-13(11)14;/h3-4,7-8,10,20H,5-6,9H2,1-2H3,(H2,18,19,21);1H |
| InChIKey | RJCTTXWTGPMWCH-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.30 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|