C18H28BrIN4O3 — CID 111928990
2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide (PubChem CID 111928990) has the molecular formula C18H28BrIN4O3 and a molecular weight of 555.26 g/mol. Its IUPAC name is 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111928990 |
| Molecular Formula | C18H28BrIN4O3 |
| Molecular Weight | 555.26 g/mol |
| Exact Mass | 554.04 |
| IUPAC Name | 2-[(2-bromo-4,5-dimethoxyphenyl)methyl]-1-ethyl-3-(2-oxo-2-pyrrolidin-1-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cc(OC)c(OC)cc1Br)NCC(=O)N1CCCC1.I |
| InChI | InChI=1S/C18H27BrN4O3.HI/c1-4-20-18(22-12-17(24)23-7-5-6-8-23)21-11-13-9-15(25-2)16(26-3)10-14(13)19;/h9-10H,4-8,11-12H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | SCNNPKGBOJLYCZ-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.26 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|