C21H23F3IN5OS — CID 111617142
1-ethyl-2-[(2-phenylmethoxy-3-pyridinyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111617142) has the molecular formula C21H23F3IN5OS and a molecular weight of 577.41 g/mol. Its IUPAC name is 1-ethyl-2-[(2-phenylmethoxy-3-pyridinyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(2-phenylmethoxy-3-pyridinyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111617142 |
| Molecular Formula | C21H23F3IN5OS |
| Molecular Weight | 577.41 g/mol |
| Exact Mass | 577.06 |
| IUPAC Name | 1-ethyl-2-[(2-phenylmethoxy-3-pyridinyl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1cccnc1OCc1ccccc1)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C21H22F3N5OS.HI/c1-2-25-20(28-12-18-29-17(14-31-18)21(22,23)24)27-11-16-9-6-10-26-19(16)30-13-15-7-4-3-5-8-15;/h3-10,14H,2,11-13H2,1H3,(H2,25,27,28);1H |
| InChIKey | HUHKVZLMBLLXQO-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 71.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.41 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|