C23H25FN4O — CID 110967482
1-ethyl-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine (PubChem CID 110967482) has the molecular formula C23H25FN4O and a molecular weight of 392.48 g/mol. Its IUPAC name is 1-ethyl-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine.
| Compound Name | 1-ethyl-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine |
|---|---|
| PubChem CID | 110967482 |
| Molecular Formula | C23H25FN4O |
| Molecular Weight | 392.48 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | 1-ethyl-2-[[4-[(3-fluorophenyl)methoxy]phenyl]methyl]-3-(pyridin-2-ylmethyl)guanidine |
| SMILES | CCN/C(=N\Cc1ccc(OCc2cccc(F)c2)cc1)NCc1ccccn1 |
| InChI | InChI=1S/C23H25FN4O/c1-2-25-23(28-16-21-8-3-4-13-26-21)27-15-18-9-11-22(12-10-18)29-17-19-6-5-7-20(24)14-19/h3-14H,2,15-17H2,1H3,(H2,25,27,28) |
| InChIKey | WOIYKNNJYNHGMN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.48 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|