C22H31IN4O — CID 110969779
2-[(4-cyclohexyloxyphenyl)methyl]-1-ethyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide (PubChem CID 110969779) has the molecular formula C22H31IN4O and a molecular weight of 494.42 g/mol. Its IUPAC name is 2-[(4-cyclohexyloxyphenyl)methyl]-1-ethyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-[(4-cyclohexyloxyphenyl)methyl]-1-ethyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 110969779 |
| Molecular Formula | C22H31IN4O |
| Molecular Weight | 494.42 g/mol |
| Exact Mass | 494.15 |
| IUPAC Name | 2-[(4-cyclohexyloxyphenyl)methyl]-1-ethyl-3-(pyridin-2-ylmethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(OC2CCCCC2)cc1)NCc1ccccn1.I |
| InChI | InChI=1S/C22H30N4O.HI/c1-2-23-22(26-17-19-8-6-7-15-24-19)25-16-18-11-13-21(14-12-18)27-20-9-4-3-5-10-20;/h6-8,11-15,20H,2-5,9-10,16-17H2,1H3,(H2,23,25,26);1H |
| InChIKey | PCGAZMUOQOFNKN-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 58.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|