C12H17F3IN7S — CID 111617585
1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111617585) has the molecular formula C12H17F3IN7S and a molecular weight of 475.28 g/mol. Its IUPAC name is 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111617585 |
| Molecular Formula | C12H17F3IN7S |
| Molecular Weight | 475.28 g/mol |
| Exact Mass | 475.03 |
| IUPAC Name | 1-ethyl-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]-3-[[4-(trifluoromethyl)-1,3-thiazol-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1C)NCc1nc(C(F)(F)F)cs1.I |
| InChI | InChI=1S/C12H16F3N7S.HI/c1-3-16-11(17-4-9-21-19-7-22(9)2)18-5-10-20-8(6-23-10)12(13,14)15;/h6-7H,3-5H2,1-2H3,(H2,16,17,18);1H |
| InChIKey | VHUPINNZPNWQTO-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|