C13H22IN7S — CID 111534933
1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide (PubChem CID 111534933) has the molecular formula C13H22IN7S and a molecular weight of 435.34 g/mol. Its IUPAC name is 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111534933 |
| Molecular Formula | C13H22IN7S |
| Molecular Weight | 435.34 g/mol |
| Exact Mass | 435.07 |
| IUPAC Name | 1-ethyl-3-[(5-ethyl-1,3-thiazol-2-yl)methyl]-2-[(4-methyl-1,2,4-triazol-3-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1nncn1C)NCc1ncc(CC)s1.I |
| InChI | InChI=1S/C13H21N7S.HI/c1-4-10-6-15-12(21-10)8-17-13(14-5-2)16-7-11-19-18-9-20(11)3;/h6,9H,4-5,7-8H2,1-3H3,(H2,14,16,17);1H |
| InChIKey | FXJSJIVVIMWLFW-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 80.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.34 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|