C24H34IN7O — CID 111591286
1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide (PubChem CID 111591286) has the molecular formula C24H34IN7O and a molecular weight of 563.49 g/mol. Its IUPAC name is 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111591286 |
| Molecular Formula | C24H34IN7O |
| Molecular Weight | 563.49 g/mol |
| Exact Mass | 563.19 |
| IUPAC Name | 1-ethyl-2-[[2-(4-methylphenyl)-1,3-oxazol-4-yl]methyl]-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1coc(-c2ccc(C)cc2)n1)NCCCc1nnc2n1CCCCC2.I |
| InChI | InChI=1S/C24H33N7O.HI/c1-3-25-24(26-14-7-9-22-30-29-21-8-5-4-6-15-31(21)22)27-16-20-17-32-23(28-20)19-12-10-18(2)11-13-19;/h10-13,17H,3-9,14-16H2,1-2H3,(H2,25,26,27);1H |
| InChIKey | GZYIXRIFYLBJGR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 93.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.49 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|