C25H40N6O — CID 109493011
2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine (PubChem CID 109493011) has the molecular formula C25H40N6O and a molecular weight of 440.64 g/mol. Its IUPAC name is 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine.
| Compound Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 109493011 |
| Molecular Formula | C25H40N6O |
| Molecular Weight | 440.64 g/mol |
| Exact Mass | 440.33 |
| IUPAC Name | 2-[2-(4-tert-butylphenyl)-2-hydroxyethyl]-1-ethyl-3-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(O)c1ccc(C(C)(C)C)cc1)NCCCc1nnc2n1CCCCC2 |
| InChI | InChI=1S/C25H40N6O/c1-5-26-24(28-18-21(32)19-12-14-20(15-13-19)25(2,3)4)27-16-9-11-23-30-29-22-10-7-6-8-17-31(22)23/h12-15,21,32H,5-11,16-18H2,1-4H3,(H2,26,27,28) |
| InChIKey | XOGVDVJNZMRZCY-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 87.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.64 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|