C18H23N7 — CID 110997243
1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine (PubChem CID 110997243) has the molecular formula C18H23N7 and a molecular weight of 337.43 g/mol. Its IUPAC name is 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine.
| Compound Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 110997243 |
| Molecular Formula | C18H23N7 |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.20 |
| IUPAC Name | 1-(6,7-dihydro-5H-pyrrolo[2,1-c][1,2,4]triazol-3-ylmethyl)-3-[2-(1H-indol-3-yl)ethyl]-2-methylguanidine |
| SMILES | C/N=C(/NCCc1c[nH]c2ccccc12)NCc1nnc2n1CCC2 |
| InChI | InChI=1S/C18H23N7/c1-19-18(22-12-17-24-23-16-7-4-10-25(16)17)20-9-8-13-11-21-15-6-3-2-5-14(13)15/h2-3,5-6,11,21H,4,7-10,12H2,1H3,(H2,19,20,22) |
| InChIKey | RKAUZTTZPWYXOF-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 82.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|