C23H26FIN6 — CID 111888582
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide (PubChem CID 111888582) has the molecular formula C23H26FIN6 and a molecular weight of 532.41 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111888582 |
| Molecular Formula | C23H26FIN6 |
| Molecular Weight | 532.41 g/mol |
| Exact Mass | 532.12 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(5-phenyl-1H-imidazol-2-yl)methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ncc(-c2ccccc2)[nH]1)NCCc1c[nH]c2cc(F)ccc12.I |
| InChI | InChI=1S/C23H25FN6.HI/c1-2-25-23(26-11-10-17-13-27-20-12-18(24)8-9-19(17)20)29-15-22-28-14-21(30-22)16-6-4-3-5-7-16;/h3-9,12-14,27H,2,10-11,15H2,1H3,(H,28,30)(H2,25,26,29);1H |
| InChIKey | UHHICKQVVNWTDM-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 80.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.41 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|