C23H25FN6 — CID 111887845
1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(1-phenylpyrazol-3-yl)methyl]guanidine (PubChem CID 111887845) has the molecular formula C23H25FN6 and a molecular weight of 404.49 g/mol. Its IUPAC name is 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(1-phenylpyrazol-3-yl)methyl]guanidine.
| Compound Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(1-phenylpyrazol-3-yl)methyl]guanidine |
|---|---|
| PubChem CID | 111887845 |
| Molecular Formula | C23H25FN6 |
| Molecular Weight | 404.49 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | 1-ethyl-3-[2-(6-fluoro-1H-indol-3-yl)ethyl]-2-[(1-phenylpyrazol-3-yl)methyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccn(-c2ccccc2)n1)NCCc1c[nH]c2cc(F)ccc12 |
| InChI | InChI=1S/C23H25FN6/c1-2-25-23(26-12-10-17-15-27-22-14-18(24)8-9-21(17)22)28-16-19-11-13-30(29-19)20-6-4-3-5-7-20/h3-9,11,13-15,27H,2,10,12,16H2,1H3,(H2,25,26,28) |
| InChIKey | OHEBVZLKWGWGQW-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 70.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.49 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|