C19H32IN5O3 — CID 111655903
1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide (PubChem CID 111655903) has the molecular formula C19H32IN5O3 and a molecular weight of 505.40 g/mol. Its IUPAC name is 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide.
| Compound Name | 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111655903 |
| Molecular Formula | C19H32IN5O3 |
| Molecular Weight | 505.40 g/mol |
| Exact Mass | 505.15 |
| IUPAC Name | 1-(3-ethoxypropyl)-3-[2-(furan-2-yl)ethyl]-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]guanidine;hydroiodide |
| SMILES | CCOCCCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCc1ccco1.I |
| InChI | InChI=1S/C19H31N5O3.HI/c1-4-26-11-6-9-20-18(21-10-8-17-7-5-12-27-17)22-15-19(2,25)16-13-23-24(3)14-16;/h5,7,12-14,25H,4,6,8-11,15H2,1-3H3,(H2,20,21,22);1H |
| InChIKey | GDDVDQOYEVHVHR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 96.84 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.40 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|