C18H33N5O3 — CID 111655712
1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine (PubChem CID 111655712) has the molecular formula C18H33N5O3 and a molecular weight of 367.49 g/mol. Its IUPAC name is 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine.
| Compound Name | 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
|---|---|
| PubChem CID | 111655712 |
| Molecular Formula | C18H33N5O3 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.26 |
| IUPAC Name | 1-ethyl-2-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-3-[3-(oxolan-2-ylmethoxy)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)(O)c1cnn(C)c1)NCCCOCC1CCCO1 |
| InChI | InChI=1S/C18H33N5O3/c1-4-19-17(20-8-6-9-25-13-16-7-5-10-26-16)21-14-18(2,24)15-11-22-23(3)12-15/h11-12,16,24H,4-10,13-14H2,1-3H3,(H2,19,20,21) |
| InChIKey | QSAZQZYVJFDPPQ-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|