C22H32N4O3 — CID 111354862
4-[[[(3-ethoxypropylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide (PubChem CID 111354862) has the molecular formula C22H32N4O3 and a molecular weight of 400.52 g/mol. Its IUPAC name is 4-[[[(3-ethoxypropylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[[[(3-ethoxypropylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 111354862 |
| Molecular Formula | C22H32N4O3 |
| Molecular Weight | 400.52 g/mol |
| Exact Mass | 400.25 |
| IUPAC Name | 4-[[[(3-ethoxypropylamino)-[2-(furan-2-yl)ethylamino]methylidene]amino]methyl]-N,N-dimethylbenzamide |
| SMILES | CCOCCCN/C(=N\Cc1ccc(C(=O)N(C)C)cc1)NCCc1ccco1 |
| InChI | InChI=1S/C22H32N4O3/c1-4-28-15-6-13-23-22(24-14-12-20-7-5-16-29-20)25-17-18-8-10-19(11-9-18)21(27)26(2)3/h5,7-11,16H,4,6,12-15,17H2,1-3H3,(H2,23,24,25) |
| InChIKey | VIVZGIZXRGYYQN-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.52 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|