C15H18BrNOS2 — CID 78861198
4-(5-bromothiophen-2-yl)-N-(1-thiophen-2-ylpropan-2-yl)butanamide (PubChem CID 78861198) has the molecular formula C15H18BrNOS2 and a molecular weight of 372.35 g/mol. Its IUPAC name is 4-(5-bromothiophen-2-yl)-N-(1-thiophen-2-ylpropan-2-yl)butanamide.
| Compound Name | 4-(5-bromothiophen-2-yl)-N-(1-thiophen-2-ylpropan-2-yl)butanamide |
|---|---|
| PubChem CID | 78861198 |
| Molecular Formula | C15H18BrNOS2 |
| Molecular Weight | 372.35 g/mol |
| Exact Mass | 371.00 |
| IUPAC Name | 4-(5-bromothiophen-2-yl)-N-(1-thiophen-2-ylpropan-2-yl)butanamide |
| SMILES | CC(Cc1cccs1)NC(=O)CCCc1ccc(Br)s1 |
| InChI | InChI=1S/C15H18BrNOS2/c1-11(10-13-5-3-9-19-13)17-15(18)6-2-4-12-7-8-14(16)20-12/h3,5,7-9,11H,2,4,6,10H2,1H3,(H,17,18) |
| InChIKey | UJVRKJRYUHYCLD-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.35 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |