C14H20BrNO3S — CID 43171239
2-[4-(5-bromothiophen-2-yl)butanoylamino]-3-methylpentanoic acid (PubChem CID 43171239) has the molecular formula C14H20BrNO3S and a molecular weight of 362.29 g/mol. Its IUPAC name is 2-[4-(5-bromothiophen-2-yl)butanoylamino]-3-methylpentanoic acid.
| Compound Name | 2-[4-(5-bromothiophen-2-yl)butanoylamino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 43171239 |
| Molecular Formula | C14H20BrNO3S |
| Molecular Weight | 362.29 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 2-[4-(5-bromothiophen-2-yl)butanoylamino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CCCc1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C14H20BrNO3S/c1-3-9(2)13(14(18)19)16-12(17)6-4-5-10-7-8-11(15)20-10/h7-9,13H,3-6H2,1-2H3,(H,16,17)(H,18,19) |
| InChIKey | RWYFCZQNGSWNNQ-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.29 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |