C14H19BrN2O4S — CID 119212149
2-[[2-[(5-bromothiophene-2-carbonyl)-methylamino]acetyl]amino]-3-methylpentanoic acid (PubChem CID 119212149) has the molecular formula C14H19BrN2O4S and a molecular weight of 391.29 g/mol. Its IUPAC name is 2-[[2-[(5-bromothiophene-2-carbonyl)-methylamino]acetyl]amino]-3-methylpentanoic acid.
| Compound Name | 2-[[2-[(5-bromothiophene-2-carbonyl)-methylamino]acetyl]amino]-3-methylpentanoic acid |
|---|---|
| PubChem CID | 119212149 |
| Molecular Formula | C14H19BrN2O4S |
| Molecular Weight | 391.29 g/mol |
| Exact Mass | 390.02 |
| IUPAC Name | 2-[[2-[(5-bromothiophene-2-carbonyl)-methylamino]acetyl]amino]-3-methylpentanoic acid |
| SMILES | CCC(C)C(NC(=O)CN(C)C(=O)c1ccc(Br)s1)C(=O)O |
| InChI | InChI=1S/C14H19BrN2O4S/c1-4-8(2)12(14(20)21)16-11(18)7-17(3)13(19)9-5-6-10(15)22-9/h5-6,8,12H,4,7H2,1-3H3,(H,16,18)(H,20,21) |
| InChIKey | WZEWJLQSXRKTFU-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |