C16H25BrN2O2S — CID 55873207
5-bromo-N-[2-[ethyl(2-ethylbutyl)amino]-2-oxoethyl]-N-methylthiophene-2-carboxamide (PubChem CID 55873207) has the molecular formula C16H25BrN2O2S and a molecular weight of 389.36 g/mol. Its IUPAC name is 5-bromo-N-[2-[ethyl(2-ethylbutyl)amino]-2-oxoethyl]-N-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[ethyl(2-ethylbutyl)amino]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55873207 |
| Molecular Formula | C16H25BrN2O2S |
| Molecular Weight | 389.36 g/mol |
| Exact Mass | 388.08 |
| IUPAC Name | 5-bromo-N-[2-[ethyl(2-ethylbutyl)amino]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
| SMILES | CCC(CC)CN(CC)C(=O)CN(C)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C16H25BrN2O2S/c1-5-12(6-2)10-19(7-3)15(20)11-18(4)16(21)13-8-9-14(17)22-13/h8-9,12H,5-7,10-11H2,1-4H3 |
| InChIKey | PMTWALUFXTUNAZ-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.36 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |