C11H16BrN3O2S — CID 119501024
5-bromo-N-methyl-N-[2-[2-(methylamino)ethylamino]-2-oxoethyl]thiophene-2-carboxamide (PubChem CID 119501024) has the molecular formula C11H16BrN3O2S and a molecular weight of 334.24 g/mol. Its IUPAC name is 5-bromo-N-methyl-N-[2-[2-(methylamino)ethylamino]-2-oxoethyl]thiophene-2-carboxamide.
| Compound Name | 5-bromo-N-methyl-N-[2-[2-(methylamino)ethylamino]-2-oxoethyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 119501024 |
| Molecular Formula | C11H16BrN3O2S |
| Molecular Weight | 334.24 g/mol |
| Exact Mass | 333.01 |
| IUPAC Name | 5-bromo-N-methyl-N-[2-[2-(methylamino)ethylamino]-2-oxoethyl]thiophene-2-carboxamide |
| SMILES | CNCCNC(=O)CN(C)C(=O)c1ccc(Br)s1 |
| InChI | InChI=1S/C11H16BrN3O2S/c1-13-5-6-14-10(16)7-15(2)11(17)8-3-4-9(12)18-8/h3-4,13H,5-7H2,1-2H3,(H,14,16) |
| InChIKey | AAZUJTBLNSMYOS-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 61.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.24 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|