C17H19BrN4O4S — CID 55832973
5-bromo-N-[2-[2-[2-(4-methoxyanilino)acetyl]hydrazinyl]-2-oxoethyl]-N-methylthiophene-2-carboxamide (PubChem CID 55832973) has the molecular formula C17H19BrN4O4S and a molecular weight of 455.33 g/mol. Its IUPAC name is 5-bromo-N-[2-[2-[2-(4-methoxyanilino)acetyl]hydrazinyl]-2-oxoethyl]-N-methylthiophene-2-carboxamide.
| Compound Name | 5-bromo-N-[2-[2-[2-(4-methoxyanilino)acetyl]hydrazinyl]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 55832973 |
| Molecular Formula | C17H19BrN4O4S |
| Molecular Weight | 455.33 g/mol |
| Exact Mass | 454.03 |
| IUPAC Name | 5-bromo-N-[2-[2-[2-(4-methoxyanilino)acetyl]hydrazinyl]-2-oxoethyl]-N-methylthiophene-2-carboxamide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)CN(C)C(=O)c2ccc(Br)s2)cc1 |
| InChI | InChI=1S/C17H19BrN4O4S/c1-22(17(25)13-7-8-14(18)27-13)10-16(24)21-20-15(23)9-19-11-3-5-12(26-2)6-4-11/h3-8,19H,9-10H2,1-2H3,(H,20,23)(H,21,24) |
| InChIKey | ZSAMYONZNWVSJN-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.33 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|