C17H18BrN3O3S — CID 55350905
N'-[2-(4-bromophenyl)sulfanylacetyl]-2-(4-methoxyanilino)acetohydrazide (PubChem CID 55350905) has the molecular formula C17H18BrN3O3S and a molecular weight of 424.32 g/mol. Its IUPAC name is N'-[2-(4-bromophenyl)sulfanylacetyl]-2-(4-methoxyanilino)acetohydrazide.
| Compound Name | N'-[2-(4-bromophenyl)sulfanylacetyl]-2-(4-methoxyanilino)acetohydrazide |
|---|---|
| PubChem CID | 55350905 |
| Molecular Formula | C17H18BrN3O3S |
| Molecular Weight | 424.32 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | N'-[2-(4-bromophenyl)sulfanylacetyl]-2-(4-methoxyanilino)acetohydrazide |
| SMILES | COc1ccc(NCC(=O)NNC(=O)CSc2ccc(Br)cc2)cc1 |
| InChI | InChI=1S/C17H18BrN3O3S/c1-24-14-6-4-13(5-7-14)19-10-16(22)20-21-17(23)11-25-15-8-2-12(18)3-9-15/h2-9,19H,10-11H2,1H3,(H,20,22)(H,21,23) |
| InChIKey | STRYLTMKPMIKFO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.32 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|