C12H13BrN2O3S3 — CID 4194172
3-[(5-bromothiophen-2-yl)sulfonylamino]-N-(thiophen-2-ylmethyl)propanamide (PubChem CID 4194172) has the molecular formula C12H13BrN2O3S3 and a molecular weight of 409.35 g/mol. Its IUPAC name is 3-[(5-bromothiophen-2-yl)sulfonylamino]-N-(thiophen-2-ylmethyl)propanamide.
| Compound Name | 3-[(5-bromothiophen-2-yl)sulfonylamino]-N-(thiophen-2-ylmethyl)propanamide |
|---|---|
| PubChem CID | 4194172 |
| Molecular Formula | C12H13BrN2O3S3 |
| Molecular Weight | 409.35 g/mol |
| Exact Mass | 407.93 |
| IUPAC Name | 3-[(5-bromothiophen-2-yl)sulfonylamino]-N-(thiophen-2-ylmethyl)propanamide |
| SMILES | O=C(CCNS(=O)(=O)c1ccc(Br)s1)NCc1cccs1 |
| InChI | InChI=1S/C12H13BrN2O3S3/c13-10-3-4-12(20-10)21(17,18)15-6-5-11(16)14-8-9-2-1-7-19-9/h1-4,7,15H,5-6,8H2,(H,14,16) |
| InChIKey | XANRGCNFDJDBDX-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.35 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |