C28H24NO4P — CID 162406679
2-benzamido-3-diphenylphosphoryl-2-phenylpropanoic acid (PubChem CID 162406679) has the molecular formula C28H24NO4P and a molecular weight of 469.48 g/mol. Its IUPAC name is 2-benzamido-3-diphenylphosphoryl-2-phenylpropanoic acid.
| Compound Name | 2-benzamido-3-diphenylphosphoryl-2-phenylpropanoic acid |
|---|---|
| PubChem CID | 162406679 |
| Molecular Formula | C28H24NO4P |
| Molecular Weight | 469.48 g/mol |
| Exact Mass | 469.14 |
| IUPAC Name | 2-benzamido-3-diphenylphosphoryl-2-phenylpropanoic acid |
| SMILES | O=C(NC(CP(=O)(c1ccccc1)c1ccccc1)(C(=O)O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C28H24NO4P/c30-26(22-13-5-1-6-14-22)29-28(27(31)32,23-15-7-2-8-16-23)21-34(33,24-17-9-3-10-18-24)25-19-11-4-12-20-25/h1-20H,21H2,(H,29,30)(H,31,32) |
| InChIKey | AOHPSOHXTACBLJ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.48 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|