C22H17FN4O2S — CID 139824759
4-[4-(azidomethylsulfanyl)phenyl]-1-(4-fluorophenyl)-2-pyridin-4-ylbutane-1,4-dione (PubChem CID 139824759) has the molecular formula C22H17FN4O2S and a molecular weight of 420.47 g/mol. Its IUPAC name is 4-[4-(azidomethylsulfanyl)phenyl]-1-(4-fluorophenyl)-2-pyridin-4-ylbutane-1,4-dione.
| Compound Name | 4-[4-(azidomethylsulfanyl)phenyl]-1-(4-fluorophenyl)-2-pyridin-4-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 139824759 |
| Molecular Formula | C22H17FN4O2S |
| Molecular Weight | 420.47 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | 4-[4-(azidomethylsulfanyl)phenyl]-1-(4-fluorophenyl)-2-pyridin-4-ylbutane-1,4-dione |
| SMILES | [N-]=[N+]=NCSc1ccc(C(=O)CC(C(=O)c2ccc(F)cc2)c2ccncc2)cc1 |
| InChI | InChI=1S/C22H17FN4O2S/c23-18-5-1-17(2-6-18)22(29)20(15-9-11-25-12-10-15)13-21(28)16-3-7-19(8-4-16)30-14-26-27-24/h1-12,20H,13-14H2 |
| InChIKey | GXGAPSIHGMCPRI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 95.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.47 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|