C26H31N3O6 — CID 51919981
[2-(1-adamantylcarbamoylamino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate (PubChem CID 51919981) has the molecular formula C26H31N3O6 and a molecular weight of 481.55 g/mol. Its IUPAC name is [2-(1-adamantylcarbamoylamino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate.
| Compound Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
|---|---|
| PubChem CID | 51919981 |
| Molecular Formula | C26H31N3O6 |
| Molecular Weight | 481.55 g/mol |
| Exact Mass | 481.22 |
| IUPAC Name | [2-(1-adamantylcarbamoylamino)-2-oxoethyl] (2S)-2-(1,3-dioxoisoindol-2-yl)-3-methylbutanoate |
| SMILES | CC(C)[C@@H](C(=O)OCC(=O)NC(=O)NC12CC3CC(CC(C3)C1)C2)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C26H31N3O6/c1-14(2)21(29-22(31)18-5-3-4-6-19(18)23(29)32)24(33)35-13-20(30)27-25(34)28-26-10-15-7-16(11-26)9-17(8-15)12-26/h3-6,14-17,21H,7-13H2,1-2H3,(H2,27,28,30,34)/t15?,16?,17?,21-,26?/m0/s1 |
| InChIKey | ICPRCMUEWMLSQZ-KOQPJMIYSA-N |
| XLogP | 2.64 |
| TPSA | 121.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.55 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|