C23H27N2O2S+ — CID 8756205
[(R)-furan-2-yl(phenyl)methyl]-[2-[2-[(4-methylphenyl)methylsulfanyl]ethylamino]-2-oxoethyl]azanium (PubChem CID 8756205) has the molecular formula C23H27N2O2S+ and a molecular weight of 395.55 g/mol. Its IUPAC name is [(R)-furan-2-yl(phenyl)methyl]-[2-[2-[(4-methylphenyl)methylsulfanyl]ethylamino]-2-oxoethyl]azanium.
| Compound Name | [(R)-furan-2-yl(phenyl)methyl]-[2-[2-[(4-methylphenyl)methylsulfanyl]ethylamino]-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8756205 |
| Molecular Formula | C23H27N2O2S+ |
| Molecular Weight | 395.55 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | [(R)-furan-2-yl(phenyl)methyl]-[2-[2-[(4-methylphenyl)methylsulfanyl]ethylamino]-2-oxoethyl]azanium |
| SMILES | Cc1ccc(CSCCNC(=O)C[NH2+][C@H](c2ccccc2)c2ccco2)cc1 |
| InChI | InChI=1S/C23H26N2O2S/c1-18-9-11-19(12-10-18)17-28-15-13-24-22(26)16-25-23(21-8-5-14-27-21)20-6-3-2-4-7-20/h2-12,14,23,25H,13,15-17H2,1H3,(H,24,26)/p+1/t23-/m1/s1 |
| InChIKey | MLNVSBGICPODTF-HSZRJFAPSA-O |
| XLogP | 3.29 |
| TPSA | 58.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.55 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|