C17H20ClN2O4S+ — CID 11933005
[2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium (PubChem CID 11933005) has the molecular formula C17H20ClN2O4S+ and a molecular weight of 383.88 g/mol. Its IUPAC name is [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium.
| Compound Name | [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
|---|---|
| PubChem CID | 11933005 |
| Molecular Formula | C17H20ClN2O4S+ |
| Molecular Weight | 383.88 g/mol |
| Exact Mass | 383.08 |
| IUPAC Name | [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(S)-furan-2-yl(phenyl)methyl]azanium |
| SMILES | O=C(C[NH2+][C@@H](c1ccccc1)c1ccco1)N[C@@H]1CS(=O)(=O)C[C@@H]1Cl |
| InChI | InChI=1S/C17H19ClN2O4S/c18-13-10-25(22,23)11-14(13)20-16(21)9-19-17(15-7-4-8-24-15)12-5-2-1-3-6-12/h1-8,13-14,17,19H,9-11H2,(H,20,21)/p+1/t13-,14+,17-/m0/s1 |
| InChIKey | HLZHYFIXHVLKPT-VBQJREDUSA-O |
| XLogP | 0.45 |
| TPSA | 92.99 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.88 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|