C18H22ClN2O3S2+ — CID 11934454
[2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium (PubChem CID 11934454) has the molecular formula C18H22ClN2O3S2+ and a molecular weight of 413.97 g/mol. Its IUPAC name is [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium.
| Compound Name | [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium |
|---|---|
| PubChem CID | 11934454 |
| Molecular Formula | C18H22ClN2O3S2+ |
| Molecular Weight | 413.97 g/mol |
| Exact Mass | 413.08 |
| IUPAC Name | [2-[[(3R,4R)-4-chloro-1,1-dioxothiolan-3-yl]amino]-2-oxoethyl]-[(R)-(4-methylphenyl)-thiophen-2-ylmethyl]azanium |
| SMILES | Cc1ccc([C@@H]([NH2+]CC(=O)N[C@@H]2CS(=O)(=O)C[C@@H]2Cl)c2cccs2)cc1 |
| InChI | InChI=1S/C18H21ClN2O3S2/c1-12-4-6-13(7-5-12)18(16-3-2-8-25-16)20-9-17(22)21-15-11-26(23,24)10-14(15)19/h2-8,14-15,18,20H,9-11H2,1H3,(H,21,22)/p+1/t14-,15+,18+/m0/s1 |
| InChIKey | JDABXTDIZCGPRM-HDMKZQKVSA-O |
| XLogP | 1.23 |
| TPSA | 79.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.97 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|