C17H22N2O4 — CID 46658533
[1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 2-phenylbutanoate (PubChem CID 46658533) has the molecular formula C17H22N2O4 and a molecular weight of 318.37 g/mol. Its IUPAC name is [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 2-phenylbutanoate.
| Compound Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 2-phenylbutanoate |
|---|---|
| PubChem CID | 46658533 |
| Molecular Formula | C17H22N2O4 |
| Molecular Weight | 318.37 g/mol |
| Exact Mass | 318.16 |
| IUPAC Name | [1-(cyclopropylcarbamoylamino)-1-oxopropan-2-yl] 2-phenylbutanoate |
| SMILES | CCC(C(=O)OC(C)C(=O)NC(=O)NC1CC1)c1ccccc1 |
| InChI | InChI=1S/C17H22N2O4/c1-3-14(12-7-5-4-6-8-12)16(21)23-11(2)15(20)19-17(22)18-13-9-10-13/h4-8,11,13-14H,3,9-10H2,1-2H3,(H2,18,19,20,22) |
| InChIKey | UDEQYEPQCXYSBB-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.37 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |