C14H18N4O6S — CID 53437757
N'-methyl-N'-[4-[[2-oxo-2-(propylamino)acetyl]amino]phenyl]sulfonyloxamide (PubChem CID 53437757) has the molecular formula C14H18N4O6S and a molecular weight of 370.39 g/mol. Its IUPAC name is N'-methyl-N'-[4-[[2-oxo-2-(propylamino)acetyl]amino]phenyl]sulfonyloxamide.
| Compound Name | N'-methyl-N'-[4-[[2-oxo-2-(propylamino)acetyl]amino]phenyl]sulfonyloxamide |
|---|---|
| PubChem CID | 53437757 |
| Molecular Formula | C14H18N4O6S |
| Molecular Weight | 370.39 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | N'-methyl-N'-[4-[[2-oxo-2-(propylamino)acetyl]amino]phenyl]sulfonyloxamide |
| SMILES | CCCNC(=O)C(=O)Nc1ccc(S(=O)(=O)N(C)C(=O)C(N)=O)cc1 |
| InChI | InChI=1S/C14H18N4O6S/c1-3-8-16-12(20)13(21)17-9-4-6-10(7-5-9)25(23,24)18(2)14(22)11(15)19/h4-7H,3,8H2,1-2H3,(H2,15,19)(H,16,20)(H,17,21) |
| InChIKey | OVNJTLQSPKKQJI-UHFFFAOYSA-N |
| XLogP | -1.22 |
| TPSA | 155.74 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.39 |
| LogP ≤ 5 | -1.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|