C20H22ClN3O2S — CID 9480240
1-(3-chlorophenyl)-3-[[4-oxo-4-(4-propylphenyl)butanoyl]amino]thiourea (PubChem CID 9480240) has the molecular formula C20H22ClN3O2S and a molecular weight of 403.94 g/mol. Its IUPAC name is 1-(3-chlorophenyl)-3-[[4-oxo-4-(4-propylphenyl)butanoyl]amino]thiourea.
| Compound Name | 1-(3-chlorophenyl)-3-[[4-oxo-4-(4-propylphenyl)butanoyl]amino]thiourea |
|---|---|
| PubChem CID | 9480240 |
| Molecular Formula | C20H22ClN3O2S |
| Molecular Weight | 403.94 g/mol |
| Exact Mass | 403.11 |
| IUPAC Name | 1-(3-chlorophenyl)-3-[[4-oxo-4-(4-propylphenyl)butanoyl]amino]thiourea |
| SMILES | CCCc1ccc(C(=O)CCC(=O)NNC(=S)Nc2cccc(Cl)c2)cc1 |
| InChI | InChI=1S/C20H22ClN3O2S/c1-2-4-14-7-9-15(10-8-14)18(25)11-12-19(26)23-24-20(27)22-17-6-3-5-16(21)13-17/h3,5-10,13H,2,4,11-12H2,1H3,(H,23,26)(H2,22,24,27) |
| InChIKey | QZRIVFDBSRGLEM-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 70.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.94 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|