C20H21ClN2O3 — CID 9339826
2-chloro-N'-[4-oxo-4-(4-propylphenyl)butanoyl]benzohydrazide (PubChem CID 9339826) has the molecular formula C20H21ClN2O3 and a molecular weight of 372.85 g/mol. Its IUPAC name is 2-chloro-N'-[4-oxo-4-(4-propylphenyl)butanoyl]benzohydrazide.
| Compound Name | 2-chloro-N'-[4-oxo-4-(4-propylphenyl)butanoyl]benzohydrazide |
|---|---|
| PubChem CID | 9339826 |
| Molecular Formula | C20H21ClN2O3 |
| Molecular Weight | 372.85 g/mol |
| Exact Mass | 372.12 |
| IUPAC Name | 2-chloro-N'-[4-oxo-4-(4-propylphenyl)butanoyl]benzohydrazide |
| SMILES | CCCc1ccc(C(=O)CCC(=O)NNC(=O)c2ccccc2Cl)cc1 |
| InChI | InChI=1S/C20H21ClN2O3/c1-2-5-14-8-10-15(11-9-14)18(24)12-13-19(25)22-23-20(26)16-6-3-4-7-17(16)21/h3-4,6-11H,2,5,12-13H2,1H3,(H,22,25)(H,23,26) |
| InChIKey | FHWXYZVSWUXGCG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|