C25H21ClN2O5 — CID 19644736
[2-oxo-2-(4-phenylphenyl)ethyl] 4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutanoate (PubChem CID 19644736) has the molecular formula C25H21ClN2O5 and a molecular weight of 464.91 g/mol. Its IUPAC name is [2-oxo-2-(4-phenylphenyl)ethyl] 4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutanoate.
| Compound Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutanoate |
|---|---|
| PubChem CID | 19644736 |
| Molecular Formula | C25H21ClN2O5 |
| Molecular Weight | 464.91 g/mol |
| Exact Mass | 464.11 |
| IUPAC Name | [2-oxo-2-(4-phenylphenyl)ethyl] 4-[2-(2-chlorobenzoyl)hydrazinyl]-4-oxobutanoate |
| SMILES | O=C(CCC(=O)OCC(=O)c1ccc(-c2ccccc2)cc1)NNC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C25H21ClN2O5/c26-21-9-5-4-8-20(21)25(32)28-27-23(30)14-15-24(31)33-16-22(29)19-12-10-18(11-13-19)17-6-2-1-3-7-17/h1-13H,14-16H2,(H,27,30)(H,28,32) |
| InChIKey | SHQKNTOPSFQQEZ-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.91 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|