C15H21FN2O3 — CID 51307897
3-fluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,4-dimethylbenzamide (PubChem CID 51307897) has the molecular formula C15H21FN2O3 and a molecular weight of 296.34 g/mol. Its IUPAC name is 3-fluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,4-dimethylbenzamide.
| Compound Name | 3-fluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,4-dimethylbenzamide |
|---|---|
| PubChem CID | 51307897 |
| Molecular Formula | C15H21FN2O3 |
| Molecular Weight | 296.34 g/mol |
| Exact Mass | 296.15 |
| IUPAC Name | 3-fluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N,4-dimethylbenzamide |
| SMILES | COCCCNC(=O)CN(C)C(=O)c1ccc(C)c(F)c1 |
| InChI | InChI=1S/C15H21FN2O3/c1-11-5-6-12(9-13(11)16)15(20)18(2)10-14(19)17-7-4-8-21-3/h5-6,9H,4,7-8,10H2,1-3H3,(H,17,19) |
| InChIKey | YJQHXVQRIIJQFK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.34 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|