C16H19FN2O3S — CID 51095013
4-fluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1-benzothiophene-2-carboxamide (PubChem CID 51095013) has the molecular formula C16H19FN2O3S and a molecular weight of 338.40 g/mol. Its IUPAC name is 4-fluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1-benzothiophene-2-carboxamide.
| Compound Name | 4-fluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1-benzothiophene-2-carboxamide |
|---|---|
| PubChem CID | 51095013 |
| Molecular Formula | C16H19FN2O3S |
| Molecular Weight | 338.40 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 4-fluoro-N-[2-(3-methoxypropylamino)-2-oxoethyl]-N-methyl-1-benzothiophene-2-carboxamide |
| SMILES | COCCCNC(=O)CN(C)C(=O)c1cc2c(F)cccc2s1 |
| InChI | InChI=1S/C16H19FN2O3S/c1-19(10-15(20)18-7-4-8-22-2)16(21)14-9-11-12(17)5-3-6-13(11)23-14/h3,5-6,9H,4,7-8,10H2,1-2H3,(H,18,20) |
| InChIKey | IGZNJHMTLKSSCV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.40 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|